共 50 条
- [43] Ferrocenyl-substituted imine ligands and their reactivity towards Fe2(CO)9;: crystal structure of Fc-C(H)=C(H)-C(H)=N-C6H11 and (η4-R1-C(H)=C(H)-C(H)=N-R2)Fe(CO)3 (R1 = C6H5, R2 = Fc; R1 = Fc, R2 = C6H11, R1 = R2 = Fc; Fc = (η5-C5H5)Fe(η5-C5H4)) INORGANICA CHIMICA ACTA, 1998, 282 (01) : 111 - 118
- [49] Synthesis, spectral characteristics, and crystal structure of the hexanuclear complex MeSi[η1,η5-C5H4(CO)2Fe(η1,η5-C5H5)Mn(CO)3]3 Russian Chemical Bulletin, 1998, 47 : 2000 - 2006