Unusual condensation of propargylamine. Generation of the 1,3-di(propargylimino)propane anion coordinated to the cobalt(III) atom

The reaction of propargylamine with the hexanuclear complex Co-6(11)(mu(3)-OH)(2)(OOCCMe3)(10)(HOOCCMe3)(4) or the polymer \Co(OH)(n)(OOCCMe3)(2-n)\(x) under an argon atmosphere afforded the unstable paramagnetic tetramine complex Co-11(OOCCMC3)(2)(H2NCH2C=CH)(4) (1). In air, if an excess of propargylamine is present, the latter complex is transformed into the complex Co-111(OOCCMe3)(2)(NH2CH2C=CH)(2)(NH2CH2C=CH)(2)[eta(2)-N,N' - (HC=CCH2N=CHCHCH=N-CH2CH=CH)] (2) containing a new ligand, viz., the 1.3-di(propargylimino)propane anion, which is a formal analog of the acetylacetonate anion. In contrast to propargylamine, 1,3-diaminopropane reacted with the Coll trimethylacetate Clusters in air to produce the cationic complex [Co-111{1,3-(NH2)(2)(CH2)(3)}(2)(OOCCMe3)(2)]+OOCCMe3- (3) without entering into condensation reactions. The structures of the resulting complexes were determined by X-ray diffraction analysis.