Synthesis, Crystal Structure and Thermal Stability of a New Binuclear Cu(II) Complex with 2-Benzoylbenzoic Acid as the Ligand

A new complex Cu-2(o-C6H5COC6H5COO)(4)(C10H8N2)(2)(H2O)(2) with 2-benzoylbenzoic acid and 2,2'-bipyridine as ligands has been synthesized in mixed methanol and water solvent. Crystal data are as follows: monoclinic, space group Cc, a = 14.0133(14), b = 16.0409(16), c = 30.372(3) angstrom, beta = 100.8950(10)degrees, V = 6704.1(12) angstrom(3), D-c = 1.364 g/cm(3), Z = 8, mu(MoK alpha) = 0.704 mm(-1), F(000) = 2840, the final R = 0.0552 and wR = 0.1431. In the crystal structure, the whole molecule consists of two copper ions, four 2-benzoylbenzoic acid molecules, two 2,2'-bipyridine molecules and two water molecules. Each central copper ion is coordinated with two nitrogen atoms from one 2,2'-bipyridine molecule and three oxygen atoms from two 2-benzoylbenzoic acids and one water molecule, respectively, giving a distorted tetragonal pyramidal geometry. Thermal stability properties of the complex were investigated.